4 differences between acidic salt and
normal salt​

Answers

Answer 1

Acidic salt ;

•made up of strong acid

•weak base

• partial replacement of the ionisable hydrogen atoms of a polybasic acid by a metal or an ammonium ion.

Normal salt ;

•made up of strong acid a

• strong base

•complete replacement of the ionisable hydrogen atoms of an acid by a metallic or an ammonium ion.


Related Questions

if you were given an unknown that contained both a sodium salt and a potassium salt, What tests would you do to prove that the unknown contained both sodium and potassium? Give the results of each test.

Answers

A flame test will be conducted. Sodium would show an orange color while potassium would show a lilac color.

What is the flame test?

The flame test is a qualitative analytical technique used to identify the presence of certain metal ions in a sample. It involves heating a sample of the substance in a flame and observing the characteristic color of the flame produced by the metal ions.

When a metal ion is heated in a flame, some of its electrons absorb energy and become excited to higher energy levels. As these electrons return to their original energy levels, they release the excess energy in the form of light. Each metal ion emits light at a characteristic wavelength or frequency, which gives rise to a unique color.

Learn more about flame test:https://brainly.com/question/6357832

#SPJ1

lewis structure of ch3ch2CH2CH2oh how to get total valence electrons? What is hybridization

Answers

Lewis structure is a type of shorthand notation that is used by chemists to represent the arrangement of electrons in a molecule.

What are Electrons?

Electrons are tiny subatomic particles with a negative electrical charge. They are the negatively charged components of atoms, and they are responsible for electrical conduction in most types of matter. Electrons are found in the space surrounding the nucleus of an atom and can move freely between atoms.

Step 1: Count the number of atoms in the molecule.

The molecule CH3CH2CH2CH2OH has 6 atoms: 1 Carbon (C), 4 Hydrogens (H), and 1 Oxygen (O).

Step 2: Assign each atom its valence electrons.

Carbon has 4 valence electrons

Hydrogen has 1 valence electron

Oxygen has 6 valence electrons

Step 3: Add up all the valence electrons.

The total number of valence electrons in CH3CH2CH2CH2OH is 4 + 4 + 1 + 1 + 6 = 16.

Hybridization is the process of combining two or more atomic orbitals to form a new set of hybrid orbitals. These hybrid orbitals can be used to explain the molecular geometry of a molecule and its chemical properties. For example, if two atomic orbitals of the same energy level are combined, the resulting hybrid orbital will be of a higher energy level than either of the two original orbitals.

To know more about electrons,

https://brainly.com/question/13998346

#SPJ1

PLEASE ANSWER SOON AS POSSIBLE
What is the volume, in liters, of 1.20 mol of C3H8 gas at STP

Answers

26.8L is the volume, in liters, of 1.20 mol of C\(_3\)H\(_8\) gas at STP. A measurement of three-dimensional space is volume.

A measurement of three-dimensional space is volume. It is frequently expressed quantitatively using SI-derived units, like the cubic metre or litre, or different imperial or US-standard units, including the gallon, quart and cubic inch. Volume and length (cubed) have a symbiotic relationship.

The volume of an envelope is typically thought of as its capacity, not as the amount of space it takes up. In other words, the volume is the quantity of fluid (liquid or gas) that the container may hold.

Volume = 1.20×22.4

              =26.8L

To know more about volume, here:

https://brainly.com/question/1578538

#SPJ1

three molecules of oxygen react with four molecules of hydrogen to produce water molecules write a balanced chemical equation

Answers

Answer:

ExpC

H

4

+  

2

O

2

 

 

C

O

2

+  

2

H

2

O

This is the balanced reaction equation for the combustion of methane.

Explanation:

The Law of Conservation of Mass basically states that matter can neither be created nor destroyed. As such, we must be able to show this in our chemical reaction equations.

If you look at the equation above, you'll see an arrow that separates the reaction equation into two parts. This represents the direction of the reaction.

To the left of the arrow, we have our reactants.

To the right of the arrow, we have our products.

The quantity of each individual element in the left must equal the quantity of each individual element in the right.

So if you look below, you'll see the unbalanced equation, and I'll try to explain how to balance the reaction.

C

H

4

+  

O

2

 

 

C

O

2

+  

H

2

O

Our reactants in this equation are  

C

H

4

and  

O

2

.

Our next step is to break these down into individual atoms.

We have:

1 C atom, 4 H atoms & 2 O atoms.

If you're confused by this, look to see the little number to the bottom right of each element, the subscript, and it tells you how many of each atom are in the molecule. Make sense?

Now we look to the other side of the equation.

Here we see our products are  

C

O

2

+  

H

2

O

Again, we break these down into individual atoms again.

We have:

1 C atom, 2 H atom, 3 O atom

If the change in Gibbs free energy for a process is positive, the process is: Select the correct answer below: O always spontaneous O always nonspontaneous O spontaneous at high temperatures O spontaneous at low temperatures

Answers

The process of changing the Gibbs free energy if positive is always nonspontaneous

What is Gibbs free energy?

Gibbs Free Energy is one of the thermodynamic parameters that states whether the continuity of a reaction occurs spontaneously or not spontaneously. The equilibrium composition of a reaction is determined by DG° and K. The value of G will change as the chemical composition of the reactants changes to the products.

Gibbs free energy is denoted by G and expressed in the equation G = H – TS.

Gibbs Helmholtz equation:

ΔG = ΔH − TΔS

This equation is very useful in predicting the spontaneity of a process.

If ∆G is negative, the process is spontaneousIf ∆G is positive, the process is not spontaneousIf it is equal to zero, the process is in equilibrium

So if the process of changing the Gibbs free energy if it is positive then the process is always nonspontaneous

Learn more about gibbs free energy negative here :

https://brainly.com/question/29753420

#SPJ4

Compare and contrast the use of fossil fuels and wind energy. (1 point) Both fossil fuels and wind energy can be used to produce electricity. However, burning fossil fuels does not pollute the atmosphere, while using Earth's wind does. O Both fossil fuels and wind energy contribute negatively to climate change. However, mining for fossil fuels is much more damaging to the environment than using wind power. Both fossil fuels and wind energy can be used to produce electricity. However, wind energy does not pollute the atmosphere, while burning fossil fuels does. Both fossil fuels and wind energy contribute negatively to climate change. However, using Earth's wind for energy is much more damaging to the environment than using fossil fuels.​

Answers

Answer:

The Answer will be provided below, please pay attention in class next time so that you don't have to be in a hurry like you are in now.

Explanation: The correct option is:

Both fossil fuels and wind energy can be used to produce electricity. However, burning fossil fuels does pollute the atmosphere, while using Earth's wind does not. Both fossil fuels and wind energy contribute to climate change, but the use of fossil fuels is much more damaging to the environment than the use of wind power.

Fossil fuels are non-renewable sources of energy that are formed over millions of years by the decomposition of organic matter. They release harmful greenhouse gases when burned, contributing to climate change. In contrast, wind energy is a renewable source of energy that uses turbines to harvest the power of wind. Wind energy does not produce any emissions, making it an environmentally friendly alternative to fossil fuels. While wind turbines can have some impacts on wildlife and habitats, the impact is much less severe than the effects of fossil fuel extraction and burning.

Added Part: Fossil fuels are non-renewable sources of energy that are derived from the remains of plants and animals that died millions of years ago. These sources include coal, oil, and natural gas. Wind energy, on the other hand, is a renewable source of energy that is generated by the kinetic energy of wind.

Here are some comparisons between fossil fuels and wind energy:

Environmental Impact: Fossil fuels have a significant negative impact on the environment. Burning fossil fuels produces greenhouse gases that contribute to climate change. The extraction of fossil fuels also has negative impacts on the air, water, and soil. Wind energy, however, has a very small environmental footprint. Wind turbines do not produce any emissions and do not require any water to generate electricity.

Energy Availability: Fossil fuels are abundant and have been the primary source of energy for decades. On the other hand, wind energy is a relatively new source of energy and the technology is still developing. However, the availability of wind energy is significant, as wind is a renewable source that is constantly available.

Sustainability: Fossil fuels are non-renewable, which means they will eventually run out. As the demand for energy continues to increase, the availability of fossil fuels will decrease. Wind energy is a renewable source of energy that will never run out.

Here are some pros and cons of both fossil fuels and wind energy:

Fossil Fuels:

Pros:

Reliable source of energy

High energy density

Large global infrastructure

Cons:

Non-renewable source of energy

Significant environmental impact

Price instability

Wind Energy:

Pros:

Renewable source of energy

Small environmental footprint

Low operating costs

Cons:

High initial costs for building wind turbines

Wind is an inconsistent source of energy

Can create noise pollution for surrounding communities

Perform the following mathematical operation, and report the answer to the appropriate number of significant figures.

1204.2 + 4.72613 = [?]

The answer is not 1208.92613​

Answers

1208.9213 not then what's the answer

Convert 12.3 newtons to pounds

Answers

2.7651500001 pound-force

i think thats the answer. Apologies if it isn't :)

Name the following hydrocarbon:
CH3CH2CH2CH2F
A. 4-fluorobutane
B. 2-fluorobutane
C. 1-fluorobutane
D. 1-fluoropentane

Answers

Answer:

The correct answer is (C)

Which is "1-fluorobutane"

Explanation:

Hope this helped if so please leave a "Rating" and "Like" and MARK me Brainliest if it was the BEST answer! THANKS! :)

The name of the hydrocarbon CH3CH2CH2CH2F is 1-fluorobutane.

In naming organic hydrocarbons, we count the number of the parent chain family. Here, we have an alkane with 4 carbons, which means that the parent chain is a family of alkane. The fourth compound in the family of an alkane is butane.

Afterwards, we will determine if there is any substituent attached to any of the carbon atoms in the chain and rank them in a way such that we have the lowest possible number.

Here, the fluorine is attached to the first carbon atom. So, it becomes 1-fluorobutane.

Learn more about the naming of hydrocarbons here:

https://brainly.com/question/16043495?referrer=searchResults

write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal​

Answers

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

25.00 cm³ of 0.250 mol dm sodium hydroxide solution is neutralised by 25.0 cm³ of sulfuric acid. Calculate the concentration of the sulfuric acid in mol dm. H₂SO4(aq) + 2NaOH(aq) → Na₂SO4(aq) + 2H₂O(l)​

Answers

concentration of sulfuric acid is 0.124mol/dm³

Given,

volume of sulfuric acid is 25 cm³

1 dm³ = 1000 cm3.

25.0 cm³ 0.250mol/dm3 NaOH solution contains (25/1000)×0.250 = 0.00625 mol NaOH.

2NaOH + H2SO4 → Na2SO4 + 2H2O

2 moles of NaOH neutralizes 1 mole of H2SO4.

Therefore, 0.00625 moles of NaOH neutralizes 0.00625/2 = 0.00312 moles of H2SO4.

So, the molarity of H2SO4 solution = (0.00312/25) × 1000 = 0.124 mol/dm³.

therefore concentration of sulfuric acid is 0.124 mol/dm³.

Learn more about concentration here:

https://brainly.com/question/17206790

#SPJ9

How many grams are in 2.12 x 1024 molecules of CH4?

Answers

34.026 Grams are there in 2.12 x 1024 grams of CH4 molecules.

What is Methane?

This compound is also known as Methane. The SI base unit for amount of substance is the mole.

1 mole is equal to 1 moles CH4, or 16.04246 grams. Use this page to learn how to convert between moles CH4 and gram.

Hydrocarbon methane (CH4) is a main constituent of natural gas. Because methane is a greenhouse gas (GHG), its presence in the atmosphere has an impact on the planet's climate and temperature.

Therefore, 34.026 Grams are there in 2.12 x 1024 grams of CH4 molecules.

To learn more about Methane, refer to the link:

https://brainly.com/question/2127750

#SPJ1

Which of these are effects of environmental change on populations? Check all that apply.


Answers

The statement "when a bottle of soda was opened, bubbles rapidly appeared in the liquid and were given off at the surface" can be categorized as an observation.

Observation refers to the act of noticing or perceiving something through the senses. In this case, the statement describes a specific event that was directly observed: the opening of a bottle of soda and the rapid appearance of bubbles in the liquid, which were then given off at the surface. This observation describes a phenomenon that can be witnessed and measured.

The appearance of bubbles when a bottle of soda is opened is a well-known and predictable occurrence. It can be explained by the principles of gas solubility and pressure.

The soda contains dissolved carbon dioxide (CO2) under high pressure, which is responsible for the carbonation. When the bottle is opened, the sudden release of pressure causes the dissolved CO2 to come out of solution, forming bubbles. These bubbles then rise to the surface and are released into the air.

While this statement captures an observed phenomenon, it does not propose a general principle or provide a comprehensive explanation of the underlying mechanisms. Therefore, it does not qualify as a law or theory, but rather as an observation based on direct sensory perception.

for such more questions on  liquid

https://brainly.com/question/13116910

#SPJ8

The theory of evolution states

Answers

Answer:

the theory of evolution states that all living things which exist today, and many more that are now extinct, evolved from simple life forms which first developed 3 billion years ago.

Explanation:

HQ5.40
Homework Answered Due Today, 11:59 PM
The reaction 3H₂(g) + N₂(g) → 2NH3(g) has an enthalpy of reaction of -92.6 kJ/mol. If 1 g of hydrogen and 2 g of nitrogen are
reacted, how much heat is produced (kJ)?

Answers

The amount of heat energy produced when 1 g of hydrogen and 2 g of nitrogen are reacted, is -6.61 KJ

How do i determine the heat energy produced?

First, we shall obtain the limiting reactant. Details below:

3H₂ + N₂ -> 2NH₃

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g Molar mass of H₂ = 2 g/molMass of H₂ from the balanced equation = 3 × 2 = 6 g

From the balanced equation above,

28 g of N₂ reacted with 6 g of H₂

Therefore,

2 g of N₂ will react with = (2 × 6) / 28 = 0.43 g of H₂

We can see that only 0.43 g of H₂ is needed in the reaction.

Thus, the limiting reactant is N₂

Finally, we the amount of heat energy produced. Details below:

3H₂ + N₂ -> 2NH₃ ΔH = -92.6 KJ

Molar mass of N₂ = 28 g/molMass of N₂ from the balanced equation = 1 × 28 = 28 g

From the balanced equation above,

When 28 grams of N₂ reacted, -92.6 KJ of heat energy were produced.

Therefore,

When 2 grams of N₂ will react to produce = (2 × -92.6) / 28 = -6.61 KJ

Thus the heat energy produced from the reaction is -6.61 KJ

Learn more about heat energy:

https://brainly.com/question/31429264

#SPJ1

Question 1

Strontium has four naturally occurring isotopes, with mass numbers 84, 86, 87, and 88.

1.) How are these isotopes alike?

A.) Each isotope has a mass of 38
B.) Each isotope has a mass of 87.62
C.) Each isotope has 38 protons

2.) How are they different?

A.) The isotope have different numbers of neutrons
B.) The isotope have different numbers of protons
C.) The isotope different numbers of electrons

3.) Why is the atomic mass of strontium listed on the periodic table not a whole number?

A.) The atomic mass of strontium listed on the periodic table is average value of 84, 86, 87, and 88
B.) The atomic mass of strontium listed on the periodic table is the weighted average of all of the naturally occurring isotopes of

4.) Which isotope is the most abundant a sample of strontium?

A.) There is not enough information to determine the most abundant isotope of strontium
B.) Strontium-88. Since the weighted average os 87.62, the most abundant isotope is likely have a mass of 88 amu
C.) Strontium-84. Isotopes with a smaller mass will have a greater impact on the weighted average because there will be more of


Question 2

Image

Question 3

Image

Question 4

1.) The energy needed to remove the least tightly bound electron from the outermost energy level of an atom.

A.) Ionization energy
B.) Atomic size
C.) Valance electron
D.) Metallic character

2.) The distance between the outermost electrons and the nucleus.

A.) Ionization energy
B.) Atomic size
C.) Valance electron
D.) Metallic character

3.) Electrons in the highest energy level of an atom.

A.) Ionization energy
B.) Atomic size
C.) Valance electron
D.) Metallic character

4.) A measure of how easily an element loses a valence electron.

A.) Ionization energy
B.) Atomic size
C.) Valance electron
D.) Metallic character

Question 1Strontium has four naturally occurring isotopes, with mass numbers 84, 86, 87, and 88.1.) How
Question 1Strontium has four naturally occurring isotopes, with mass numbers 84, 86, 87, and 88.1.) How

Answers

The correct answers are given below:

The answers to the Strontium Isotopes questions

1.) How are these isotopes alike?

C.) Each isotope has 38 protons

2.) How are they different?

A.) The isotope have different numbers of neutrons

3.) Why is the atomic mass of strontium listed on the periodic table not a whole number?

B.) The atomic mass of strontium listed on the periodic table is the weighted average of all of the naturally occurring isotopes of strontium.

4.) Which isotope is the most abundant a sample of strontium?

B.) Strontium-88. Since the weighted average is 87.62, the most abundant isotope is likely to have a mass of 88 amu.

Question 2:

1.) What is the name of the process shown in the image?

A.) Condensation

2.) What is the direction of heat flow in this process?

B.) Heat flows out of the system

3.) What is happening to the temperature of the gas during this process?

A.) The temperature of the gas is decreasing

4.) Which of the following best describes the relationship between the pressure and volume of the gas during this process?

D.) As the volume decreases, the pressure increases

Question 3:

1.) What is the name of the ion formed by the element in Group 2 and Period 3?

C.) Mg2+

2.) What is the name of the ion formed by the element in Group 7 and Period 2?

D.) Cl-

3.) Which element has the highest electronegativity?

D.) Fluorine

4.) Which element has the largest atomic radius?

A.) Francium

Question 4:

1.) The energy needed to remove the least tightly bound electron from the outermost energy level of an atom.

A.) Ionization energy

2.) The distance between the outermost electrons and the nucleus.

B.) Atomic size

3.) Electrons in the highest energy level of an atom.

C.) Valence electron

4.) A measure of how easily an element loses a valence electron.

D.) Metallic character

Read more about valence electrons here:

https://brainly.com/question/371590

#SPJ1

Light shining on solar cells produces a current that charges a solar calculator. Which model of light does this example support? OA. It supports the particle model. OB. It supports the wave model. OC. It supports the interference model. OD. It supports the diffraction model. SUBMIT Light shining on solar cells produces a current that charges a solar calculator . Which model of light does this example support ? OA . It supports the particle model . OB . It supports the wave model . OC . It supports the interference model . OD . It supports the diffraction model . SUBMIT​

Answers

The  model of light does the example supports is the particle model.

What is the wave-particle duality model of light?

The wave-particle duality model of light is a model which suggests that light behaves both as a [article and as a wave.

The wave-like property is seen in its properties such as reflection, refraction, diffraction, etc.

The particle nature of light is seen in the photoelectric effect and the Compton effect.

Light shining on solar cells produces a current that charges a solar calculator is an example of the photoelectric effect.

Therefore, the model of light does this example support is the particle model.

Learn more about wave-particle model of light at: https://brainly.com/question/14264284

#SPJ1

Ocean water contains 3.3 % NaCl by mass.
How much salt can be obtained from 234g of seawater?

Answers

Answer:

Ans: 8.9 NaCl

Explanation:

Ocean water contains 3.5 nacl by mass how much salt can be obtained from 254 g of seawater

Question: Ocean water contains 3.5% NaCl by mass. How much salt can be obtained from 254g of seawater?

9. What coefficient of H+ balances the atoms in this half-reaction?
H+ + MnO₂ → Mn²+ + H₂O

Answers

Answer:4

Explanation:To balance the equation you need to make the number of each element equivalent in both sides.

To start add a 2 in front of the MnO2 which balances the Mn.

Then balance the oxygen by adding a 4 in front of H20.

The H then needs a 8 as it’s coefficient.

What is the molarity of a solution containing 5.035 grams of FeCIe in enough water to make 500 mL of solution?

Answers

To calculate the molarity of the solution, we first need to determine the number of moles of FeCl2 present in the solution.

The molar mass of FeCl2 is 126.75 g/mol (55.85 g/mol for Fe and 35.45 g/mol for Cl).

Number of moles of FeCl2 = mass of FeCl2 / molar mass of FeCl2
= 5.035 g / 126.75 g/mol
= 0.0397 mol

Now we can calculate the molarity of the solution:

Molarity = moles of solute / liters of solution

Since we have 500 mL of solution, we need to convert it to liters by dividing by 1000:

Liters of solution = 500 mL / 1000 mL/L
= 0.5 L

Now we can calculate the molarity:

Molarity = moles of solute / liters of solution
= 0.0397 mol / 0.5 L
= 0.0794 M

Therefore, the molarity of the solution containing 5.035 grams of FeCl2 in enough water to make 500 mL of solution is 0.0794 M.

Can someone balance these equations and show work and not just the answer please?
1. SO2 + H2 → H2S + H2O
2. CaCl2 + Na2CO3 → CaCO3 + NaCl
3. HNO3 → NO2 + H2O + O2
4. Al + H2SO4 → Al2(SO4)3 + H2

Answers

1. 2SO2 + 2H2 ➡️ 2H2S + 2H20

2. CaCl2 + Na2CO3 ➡️ CaCO3 + 2NaCl

3. 2HNO3 ➡️ NO2 + H2O + 02

4. 12Al + H2SO4 ➡️ A12(SO4)3 + H2

CuBr2 percent composition

Answers

The percent composition of CuBr₂ is approximately 28.46% of Cu and 71.54% of Br.

To determine the percent composition of CuBr₂ (copper(II) bromide), we need to calculate the mass of each element in the compound and then divide it by the molar mass of the entire compound.

The molar mass of CuBr₂ can be calculated by adding up the atomic masses of copper (Cu) and bromine (Br) in the compound. The atomic masses of Cu and Br are approximately 63.55 g/mol and 79.90 g/mol, respectively.

Molar mass of CuBr₂ = (63.55 g/mol) + 2(79.90 g/mol) = 223.35 g/mol

Now, let's calculate the percent composition of each element in CuBr₂:

Percent composition of copper (Cu):

Mass of Cu = (63.55 g/mol) / 223.35 g/mol × 100% ≈ 28.46%

Percent composition of bromine (Br):

Mass of Br = 2(79.90 g/mol) / 223.35 g/mol × 100% ≈ 71.54%

Therefore, the percent composition of CuBr₂ is approximately:

- Copper (Cu): 28.46%

- Bromine (Br): 71.54%

These values represent the relative mass percentages of copper and bromine in the compound CuBr₂.

for more such questions on composition

https://brainly.com/question/28250237

#SPJ8

The acetoacetic ester synthesis is a method for preparing methyl ketones from alkyl halides.

a. True
b. False

Answers

The answer is A) true

What is the subshell notation and the number of orbitals that can have the quantum numbers n = 5, ℓ = 2?

Answers

Answer:

5d

Explanation:

Shell s. p. d. f

L. 0. 1. 2. 3

The value of the angular quantum number, l gives an information about the energy subshell and the number of orbitals. Hence, the subshell notation for the quantum number in question is d and has 5 orbitals

The angular quantum number, l = 2

The energy subshell corresponding to l = 2 would be ;

s ___ p ___ d ____ f0 ___ 1 ___ 2 ____ 3

Hence, the quantum number corresponds to the d - subshell

According to the magnetic quantum number, m ;;

At, l = 2 :

m = {-2, - 1, 0, 1, 2} = 5

The value of m denotes the number of orbitals which is 5

Therefore, the subshell notation and number of orbitals are d and 5 respectively.

Learn more :https://brainly.com/question/2591270

In the reaction, 2H2(g) + O2(g)
which the reactants appear is:
2H2O(1), the phase of matter in
a) solid.
b) liquid.
c) gas.
d) plasma.

Answers

Answer:

b liquid

Explanation:

2H

2

(g)+O

2

(g)⟶2H

2

O(l) is the correction reaction as during formation of water both hydrogen and oxygen are in gaseous form and produces water in liquid form.

under what circumstances do you think credit cards should NOT be used ?

Answers

It's never a good idea to use your credit card when experiencing strong emotions, especially if you tend to steer toward 'retail therapy.

2 A high school student takes a lump of magnesium with a volume of 150.0 mL and adds it to a beaker of
an aqueous solution of aluminum nitrate. What is the mass of the solid aluminum that forms?
Solid magnesium has a density of 1.738 g/cm³.

Answers

The mass of the solid aluminum that forms are 192.73 grams

To determine the mass of solid aluminum that forms, we need to use stoichiometry and the balanced chemical equation for the reaction between magnesium and aluminum nitrate.

The balanced chemical equation is:

3 Mg + 2 Al(\(NO_{3}\))3 → 3 Mg(\(NO_{3}\))2 + 2 Al

The equation shows that 3 moles of magnesium react with 2 moles of aluminum to produce 2 moles of aluminum nitrate.

To calculate the mass of solid aluminum, we need to know the amount of magnesium used. Given that the volume of the magnesium is 150.0 mL and its density is 1.738 g/cm³, we can calculate the mass of magnesium using the formula:

Mass = Volume × Density

Mass of magnesium = 150.0 mL × 1.738 g/cm³ = 260.7 g

Now, using the molar mass of magnesium (24.31 g/mol) and the molar ratio from the balanced equation, we can determine the moles of magnesium used:

Moles of magnesium = Mass of magnesium / Molar mass of magnesium

= 260.7 g / 24.31 g/mol

= 10.72 mol

According to the stoichiometry of the balanced equation, the ratio of moles of magnesium to moles of aluminum is 3:2. Therefore, the moles of aluminum formed will be:

Moles of aluminum = (2/3) × Moles of magnesium

= (2/3) × 10.72 mol

= 7.15 mol

Finally, we can calculate the mass of solid aluminum using its molar mass (26.98 g/mol):

Mass of aluminum = Moles of aluminum × Molar mass of aluminum

= 7.15 mol × 26.98 g/mol

= 192.73 g

Therefore, the mass of the solid aluminum that forms is approximately 192.73 grams.

Know more about the Balanced chemical equation here:

https://brainly.com/question/13451900

#SPJ8

the rate of decomposition of acetaldehyde, ch3cho(g) , into ch4(g) and co(g) in the presence of i2(g) at 800 k follows the rate law rate of reaction

Answers

The catalyst for the reaction is I2 and the step which is slower is second step

The rate law expression shows that the rate of the reaction is directly proportional to the concentration of I2. This indicates that I2 is involved in the rate-determining step of the reaction, which is likely the slowest step in the overall reaction.

From the mechanism given, we can see that the first step involves the reaction between CH3CHO and I2 to form CH3I, HI, and CO. The second step involves the reaction between CH3I and HI to form CH4 and I2. The rate of the overall reaction will be limited by the slower of these two steps.

To determine the slower step, we need to look at the reaction intermediates in each step. In the first step, the intermediate HI is a radical, which is highly reactive and likely to react quickly with other species present in the reaction mixture. In contrast, in the second step, the intermediate CH3I is relatively stable and less likely to react quickly with other species.

Therefore, the slower step is likely the second step, which involves the reaction between CH3I and HI to form CH4 and I2. This step is likely rate-determining and determines the overall rate of the reaction.

Learn more about catalyst here:

https://brainly.com/question/1565029

#SPJ4

the complete question is :

At 800 K, the rate of decomposition of aldehyde (CH3CHO) into CCH and CO follows the rate law: r=K[CCH3CHO][I2]. The decomposition is thought to follow a two-step mechanism:

CH3CHO+I2→CH3I+HI+CHOCH3I+HI→CH4+I2

What is the reaction's catalyst? Which of the two steps is the more difficult?

The yellow beams in the model represent equal amounts of radiation coming from the Sun.

A. All parts of Earth’s surface get sunlight at the same angle and of the same intensity.
B. The regions near the poles get the most-intense and most-direct sunlight.
C. Sunlight is more spread out at the poles than at the equator.
D. Higher latitudes get less-direct sunlight than latitudes near the equator.

PLEASE HELP ME!!

The yellow beams in the model represent equal amounts of radiation coming from the Sun.A. All parts of

Answers

Answer:

C and D

Explanation:

It is right because i did a quiz and i got c and d right hope this helps:)

Answer:

it is C,D

Explanation:

test proved

which memrane lines the abdomino pelvic cavity

Answers

Answer:

The peritoneum

Explanation:

The peritoneum is the serous membrane that surrounds several organs in the abdominopelvic cavity. The tunica vaginalis is the serous membrane, which surrounds the male gonad, the testis. The two layers of serous membranes are named parietal and visceral. Between the two layers is a thin fluid filled space.

hope it helps, and pls answer this https://brainly.com/question/22410918

tysm if u do ill give brainliest :D

Other Questions
For each of the trees in the question 1, perform a find with path compression on the deepest node Which of these was an effect of the Battle of Medina? Spain sold Mexico to the United States. American filibusters gave up trying to take over Texas. Texan rebels defeated the Spanish army. It encouraged others to join the fight against the Spanish. x3 +y3 when x=3 and y=4 How do you distinguish between an elastic and i elastic collision? ( Consider each to be complete when awarding this question.) Question:The electrical resistance (R) of awire varies directly as its length (I)and inversely as the square of itsdiameter (d). A wire with a lengthof 5.0 m and a diameter of 0.25cm has a resistance of 20 Q(ohms). Find the electricalresistance in a 10 m long wire thathas twice the diameter. If you were babysitting, would you ratherCharge $5 for the first hour and $8 for each additional hour?OrCharge $15 for the first hour and $6 for each additional hour?Explain your reasoning. helppp the book is Enders game. (-x-3y=4) (y=-2+2) use the substitution method please help Milner Company is working on two job orders. The job cost sheets show the following. Assign costs to work in process. Job 201 Job 202 Direct materials $7,200 $9,000 Direct labor 4,000 8,000 Manufacturing overhead 5,200 9,800 Required:Prepare the three summary entries to record the assignment of costs to Work in Process from the data on the job cost sheets. n = 16a. Divide both sides by 2b. Take the square root of both sidesc. Square both sidesd. None of the above After moving down a group in the periodic table, the number of valence electrons HELPPP!!!Pleaseee!!! A rectangular garden has a length of 7 feet and a width of 6 feet what is the area of the garden Ryan took a total of 15 pages of notes during 3 hours of class . After attending 4 hours of class, how many total pages of notes will Ryan have in his notebook ? 2. A yield sign _____ * 10 points A. means that a driver must stop before entering traffic. B. means that a driver should give way to other drivers, pedestrians, or cyclists. C. means two roads are separating. D. are frequently found in residential neighborhoods. A force of 75 N is applied to a spring, causing it to stretch 0. 3 m. What is the spring constant of the spring? 0. 004 N/m 22. 5 N/m 75. 3 N/m 250 N/m. Due now pls helpThe following is an excerpt from a speech Frederick Douglass delivered to the International Council of Women in Washington, D. C. , April 1888. In the excerpt, is Douglass's use of Theodore Parker's grades relevant?Select one:Yes, because he uses them as the basis for explaining the greatness of the movementNo, because Theodore Parker was not a member of the movement for women's equalityNo, because he does not prove that Theodore Parker had sufficient expertise to evaluate greatnessYes, because he uses the women as an example of Theodore Parker's importance Which of the following is an advantage of Web-based surveys?A. Respondents can be interviewed in a carefully controlled environmentB. Large samples can be recruited for surveys.C. There is no risk of repeat responders.D. There is little chance of responders deliberately sabotaging the results. why might the personality traits of dictators matter more than those of democratically elected leaders? during an assessment, the nurse first performs the action shown. after that the nurse asks the client to sit up with their legs dangling from the edge of the table. what is the nurse assessing?