Answer:
1. The empirical formula is C₄H₅N₂O
2. The molecular formula is C₈H₁₀N₄O₂
Explanation:
The following data were obtained from the question:
Mass of compound = 200 g
Carbon (C) = 98.061 g
Hydrogen (H) = 10.381 g
Oxygen (O) = 32.956 g
Empirical formula =?
Molecular formula =?
Next, we shall determine the mass of nitrogen in the compound. This can be obtained as follow:
Nitrogen (N) = 200 – (98.061 + 10.381 + 32.956)
Nitrogen (N) = 200 – 141.398
Nitrogen (N) = 58.602 g
1. Determination of the empirical formula of the compound.
C = 98.061 g
H = 10.381 g
O = 32.956 g
N = 58.602 g
Divide by their molar masses
C = 98.061 /12 = 8.172
H = 10.381 /1 = 10.381
O = 32.956 /16 = 2.060
N = 58.602 /14 = 4.186
Divide by the smallest
C = 8.172 /2.060 = 4
H = 10.381 / 2.060 = 5
O = 2.060 / 2.060 = 1
N = 4.186 / 2.060 = 2
Thus, the empirical formula of the compound is C₄H₅N₂O
2. Determination of the molecular formula of the compound.
Empirical formula of the compound => C₄H₅N₂O
Molar mass of compound = 194.101 g/mol
Molecular formula =.?
[C₄H₅N₂O]n = 194.101
[(12×4) + (1×5) + (14×2) + 16]n = 194.101
[48 + 5 + 28 + 16]n = 194.101
97n = 194.101
Divide both side by 97
n = 194.101 /97
n = 2
Molecular formula => [C₄H₅N₂O]n
=> [C₄H₅N₂O]2
=> C₈H₁₀N₄O₂
Answer and I’ll give you brainliest!
What type of reaction is this *
N2 + H2 → NH3
O synthesis
O combustion
O decomp
O single
O double
What the expected outcome is, if the MDS is successfully implemented
If the MDS (Minimum Data Set) is successfully implemented, several positive outcomes can be expected. The MDS is a standardized assessment tool used in healthcare settings to evaluate the physical, mental, and psychosocial well-being of patients.
Its successful implementation can lead to improved patient care, more efficient resource allocation, and enhanced data analysis.With the MDS in place, healthcare providers can gather consistent and comprehensive data about patients, enabling better understanding of their needs and tailoring of individualized care plans.
This can result in improved treatment outcomes and patient satisfaction. Additionally, the MDS facilitates effective communication and information sharing among healthcare professionals, leading to coordinated care and reduced errors.From a broader perspective, successful implementation of the MDS allows for accurate and reliable data collection, enabling robust research and evidence-based decision-making.
This can contribute to advancements in healthcare practices, policy development, and quality improvement initiatives. Ultimately, the successful implementation of the MDS can enhance patient outcomes, improve healthcare delivery, and drive positive changes in the healthcare system as a whole.
For more such questions on outcomes
https://brainly.com/question/30417322
#SPJ11
Which circuits are parallel circuits?
Circuits C and D are parallel circuits. Therefore, options C and D are correct.
Parallel circuits are a type of electrical circuit configuration where multiple components are connected in parallel to the same power source. In a parallel circuit, each component has its own separate path for current to flow. It allows independent current flow through each component.
In a parallel circuit, the components, such as resistors, lamps, or other electrical devices, are connected side by side, with each component having its own branch or "loop" connecting it to the power source.
Learn more about parallel circuits, here:
https://brainly.com/question/14997346
#SPJ1
The composition of a compound is 28.73% K, 1.48% H, 22.76% P, and 47.03% O. The molar mass of the
compound is 136.1 g/mol.
I
The compound has an empirical formula of \(K_2H_2P_2O_8\) and a molecular formula of \(K_2HPO_4\).
The given compound has a percent composition of K = 28.73%, H = 1.48%, P = 22.76%, and O = 47.03%. Its molar mass is 136.1 g/mol. To determine its molecular formula, we need to find its empirical formula and calculate its molecular formula from its empirical formula.The empirical formula is the smallest whole number ratio of atoms in a compound. It can be determined by converting the percent composition of the elements into their respective moles and dividing each by the smallest number of moles calculated. The moles of K, H, P, and O in 100 g of the compound are: K = 28.73 g x (1 mol/39.1 g) = 0.734 molH = 1.48 g x (1 mol/1.01 g) = 1.46 molP = 22.76 g x (1 mol/30.97 g) = 0.736 molO = 47.03 g x (1 mol/16.00 g) = 2.94 molDividing each by the smallest number of moles gives the following ratios: K = 0.734/0.734 = 1H = 1.46/0.734 = 2P = 0.736/0.734 = 1.002O = 2.94/0.734 = 4. The empirical formula of the compound is \(K_2H_2P_2O_8\). To calculate the molecular formula, we need to determine the factor by which the empirical formula should be multiplied to obtain the molecular formula. This can be done by comparing the molar mass of the empirical formula to the molar mass of the compound.The molar mass of \(K_2H_2P_2O_8\) is: \(M(K_2H_2P_2O_8)\) = (2 x 39.1 g/mol) + (2 x 1.01 g/mol) + (2 x 30.97 g/mol) + (8 x 16.00 g/mol) = 276.2 g/mol. The factor by which the empirical formula should be multiplied is: M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula is obtained by multiplying the empirical formula by this factor: \(K_2H_2P_2O_8 * 0.4935 = K_2HPO_4\). Therefore, the molecular formula of the compound is \(K_2HPO_4\).The molecular formula of the given compound having a composition of 28.73% K, 1.48% H, 22.76% P, and 47.03% O with a molar mass of 136.1 g/mol is \(K_2HPO_4\). The empirical formula of the compound is \(K_2H_2P_2O_8\). The compound's molecular formula is calculated by determining the factor by which the empirical formula should be multiplied to obtain the molecular formula. The factor is M(molecular formula)/M(empirical formula) = 136.1 g/mol/276.2 g/mol = 0.4935. The molecular formula of the compound is obtained by multiplying the empirical formula by this factor, resulting in the molecular formula \(K_2HPO_4\).For more questions on empirical formula
https://brainly.com/question/13058832
#SPJ8
The correct question would be as
The composition of a compound is 28.73% K. 1.48% H, 22.76% P, and 47.03% O. The molar mass of the compound is 136.1 g/mol. What is the Molecular Formula of the compound?
\(KH_2PO_4\\KH_3PO_4\\K_2H_4P_20_{12}\\K_2H_3PO_6\)
Find the mass of 3.9 x 1023 molecules of carbon dioxide gas at STP conditions. *
O 28.6 grams
O 67.7 grams
O 76.4 grams
O 19.1 grams
The molar mass (formula weight) of carbon dioxide (CO2) is 44.01 g/mol.
At STP (Standard Temperature and Pressure), which is defined as 0°C (273.15 K) and 1 atm of pressure, 1 mole of any gas occupies 22.4 L of volume.
Now, we have 3.9 x 10^23 molecules of CO2:
- To find the number of moles, we divide the number of molecules by Avogadro's number:
n = N/Na = 3.9 x 10^23/6.022 x 10^23 = 0.648 moles
- To find the mass, we multiply the number of moles by the molar mass:
mass = n x M = 0.648 mol x 44.01 g/mol = 28.52 grams
Therefore, the mass of 3.9 x 10^23 molecules of carbon dioxide gas at STP is approximately 28.6 grams (option A).
A geologist determines that a rock is approximately 123,000,000 years old. Which of the following is the correct way to express the number in scientific notation?
The correct way to express the number 123,000,000 years old in scientific notation is 1.23 x 10⁸.
What is Scientific notation?This is referred to as a way of expressing numbers which are too large or too small and is often difficult to write them in decimal form. An example of such large numbers is 123,000,000.
This type of numbers can be written in the powers of 10 which helps compress it into smaller forms.For example 1000 can be written in the form 1 × 10³ which when expressed will still give the same result.
In the case of 123,000,000, we count from the back and put the decimal point between the firs two digits and the number counted is then expressed as the power of the number being expressed. We count eight times to get to 1.23 which is then expressed as 1.23 x 10⁸ therefore making it the correct choice.
Read more about Scientific notation here https://brainly.com/question/1767229
#SPJ1
S this true or false most energy we use comes from fossil fuels
Answer:
True. Hope this helps. :)
How many moles are in 1.5 x 10^23 atoms of fluorine?
Answer: 0.125 moles F2
Explanation: 1.5x1023 atoms of F = 0.75x10^23 molecules F2
moles F2 = 0.75x10^23/avogadro number = 0.125 moles
There are 0.25 moles in 1.5 x \(10^{23}\) atoms of fluorine.
Given,
How many moles are in one atom?
In one mole we have,
6.02 x \(10^{23}\) atoms.
1 mole = 6.02 x \(10^{23}\) atoms
Find the number of moles in 1.5 x \(10^{23}\) atoms of fluorine.
We have,
1 mole = 6.02 x \(10^{23}\) atoms
Multiply 1.5 x \(10^{23}\) / 6.02 x \(10^{23}\) on both sides
1.5 x \(10^{23}\) / 6.02 x \(10^{23}\) x 1 mole = 1.5 x \(10^{23}\) / 6.02 x \(10^{23}\) x 6.02 x \(10^{23}\) atoms
1.5/6.02 mole = 1.5 x \(10^{23}\) atoms
0.25 moles = 1.5 x \(10^{23}\) atoms.
Thus there are 0.25 moles in 1.5 x \(10^{23}\) atoms of fluorine.
Learn more about finding the number of moles in 25.0g of ammonium here:
https://brainly.com/question/21732146
#SPJ2
which energy transformation took place?
Answer:
C
Explanation:
The battery is chemical energy. When it is used in the flashlight, it produces light and thermal energy
PLZ MARK BRAINLIEST :)
The measure of the length of events and the duration of intervals between events
The measure of the length of events and the duration of intervals between events is time.
What is time?The duration of events or the gaps between them can be measured, compared, or even ordered using time. The lengthy period of time that the Earth's geologic history takes up is known as geologic time. Starting at the beginning of the Archean Eon formal geologic time runs until the present. Geology is defined as the "Science of the Earth."
Geology is the fundamental Earth science that examines how the earth created, its structure and composition, and the various forces acting on it. It is sometimes known as geoscience or earth science.
Learn more about time at;
https://brainly.com/question/479532
#SPJ1
is the liter value for titration molarity calculation the difference between the final and inital values
NaOH has ais a liter value for titration molarity of 1 mole.
Molarity-
The amount of a substance in a specific volume of solution is known as its molarity (M). The number of moles of a solute per liter of a solution is known as molarity. The molar concentration of a solution is another term for molarity.
If you know how many grams of NaOH is dissolved in a known amount of solvent, you can use the formula below to calculate its molarity.
The molarity of NaOH is determined, for instance, when 10 gm of NaOH is dissolved in 250 ml of water.
Molarity is calculated as (Weight of NaOH taken*1000)/(250*NaOH's molecular weight).
Molarity equals (10*1000)/(250*40).
NaOH has a molarity of 1 mole.
Know more about Molarity
https://brainly.com/question/17138838
#SPJ4
The full question-
How do you calculate the molarity of NaOH?
Zinc reacts with Hydrochloric Acid in a single replacement reaction. If you have 8 g of of zinc metal, what mass of each product would you produce?
Answer:
\(16.68g ZnCl_2\)
\(0.2472g H_2\)
Explanation:
1.)Write equation:
\(Zn(aq)+HCl(aq)== > ZnCl_2(aq)+H_2(g)\)
2.)Balance:
\(Zn(aq)+2HCl(aq)== > ZnCl_2(aq)+H_2(g)\)
3.)Convert:
\(8g Zn/\frac{1mol Zn}{65.380g Zn}/\frac{1mol ZnCl_2}{1mol Zn}/\frac{136.28g ZnCl_2}{1mol ZnCl_2} =16.68g ZnCl_2\)
\(8g Zn/\frac{1mol Zn}{65.380g Zn}/\frac{1 molH_2}{1molZn}/\frac{2.02g H_2}{1mol H_2}=0.2472g H_2\)
(This does not include sig figs)
You can determine from the table earlier in this lesson that the energy stored in a gallon of gasoline is actually 65 times greater than the energy stored in a stick of dynamite. However, the energy in a stick of dynamite is released all in one instant, while the energy from a gallon of gasoline is usually released in a more controlled manner. Why is the rate at which energy is output from a system important?
Answer:
Explanation:
Safety: The rate of energy release determines how quickly and explosively the energy is released. In the case of the stick of dynamite, the rapid and instantaneous release of energy can cause a violent explosion. On the other hand, the controlled release of energy from gasoline allows for safer and more manageable energy output, reducing the risk of accidents and minimizing potential harm.
Efficiency: The rate at which energy is output affects the efficiency of a system. In many practical applications, such as engines or power generation, it is desirable to convert energy into useful work as efficiently as possible. Controlling the rate of energy release allows for a more efficient conversion of energy, minimizing waste and maximizing the desired output.
Control and Functionality: Different systems require energy to be released at specific rates to perform their intended functions. For example, in an internal combustion engine, the controlled and timed release of energy from fuel allows for the synchronized movement of engine components, resulting in the desired mechanical work. Controlling the rate of energy output ensures that a system operates effectively and performs its intended function.
Environmental Impact: The rate at which energy is output can also impact the environment. In processes that release energy too rapidly or uncontrollably, such as certain combustion reactions or explosions, there can be significant environmental consequences, including air pollution, damage to ecosystems, and the release of harmful byproducts. Controlling the rate of energy release allows for better management and mitigation of these environmental impacts.
Overall, the rate at which energy is output from a system is crucial for safety, efficiency, control, functionality, and environmental considerations. By regulating and optimizing the rate of energy release, we can ensure that energy is utilized effectively and responsibly in various applications.
What is technology?
A. Something created using science for use by society.
B. A method that is used to solve problems.
XO C. The steps that engineers go through to create a product.
D. An understanding of something new.
Something created for using science for use by society. Hence, option A is correct.
What is science?Science is the pursuit and application of knowledge and understanding of the natural and social world following a systematic methodology based on evidence.
Technology is the use of science to provide human problem. It can be in the form of a machine, tool or equipment. As long as it involves applying a scientific process, it's technology.
Example of technology is a computer. It's used to store and process data in a faster way. Old technology also included Hammer, Saw, Grinding Machines etc.
Hence, option A is correct.
Learn more about technology here:
https://brainly.com/question/9171028
#SPJ1
Which of the following is a compound? *
A. aluminum
B. carbon
C. oxygen
D. sugar
Answer:
C. OXYGEN
Explanation:
1. A 40,000 kg plane is accelerating at a rate of 4m/s2. How much force does the engine put forth?
Answer:
160000
Explanation:
F=ma
m=40000
a=4
if a 40,000 kilogram plane is accelerating at a rate of 4 meters/second², then the force generated by the engine would be 160000 Newtons.
What is Newton's second law?Newton's Second Law states that The resultant force acting on an object is proportional to the rate of change of momentum.
As given in the problem we have to find out the force generated by the engine of the plane if a 40,000-kilogram plane is accelerating at a rate of 4 meters/second²,
The mass of the plane = 40000 kilograms
The acceleration of the plane = 4 meters/second²
The force generated by the engine of the plane = 40000×4
= 160000 Newtons
Thus, the engine would generate a force of 160000 Newtons.
To learn more about Newton's second law here, refer to the link;
brainly.com/question/13447525
#SPJ2
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
Which of the following set of quantum numbers (ordered n, ℓ, mℓ ) are possible for an electron in an atom? Check all that apply
a. 2, 1, 3
b. 5, 3, -3
c. 4, 3, -2
d. -4, 3, 1
e. 2, 1, -2
f. 3, 2, 2
g. 3, 3, 1
the possible quantum numbers (ordered n, ℓ, mℓ ) are:Option B.5, 3, -3 and Option C. 4, 3, -2
The quantum numbers n, ℓ, mℓ represent respectively the principal quantum number, the orbital angular momentum quantum number and the magnetic quantum number.
These are the three most important quantum numbers. T
here is another quantum number called the spin quantum number, denoted by ms.
Let's see which of the given quantum number sets is possible.2, 1, 3 is not possible because for ℓ = 1, mℓ can only be -1, 0, or 1. 5, 3, -3 is possible.4, 3, -2 is possible. -4, 3, 1 is not possible.
For any value of ℓ, mℓ must be between -ℓ and +ℓ. e. 2, 1, -2 is not possible because for ℓ = 1, mℓ can only be -1, 0, or 1. f. 3, 2, 2 is not possible because for ℓ = 2, mℓ can only be -2, -1, 0, +1, or +2. g. 3, 3, 1 is not possible because for any value of ℓ, mℓ must be between -ℓ and +ℓ.
Therefore, the possible quantum numbers (ordered n, ℓ, mℓ ) are:5, 3, -34, 3, -2
For more questions on quantum numbers
https://brainly.com/question/30881398
#SPJ8
When considering free energy change, biochemists usually define a standard state, the biochemical standard state, which is modified from the chemical standard state to fit biochemical applications. Determine which of the phrases describe the biochemical standard state, the chemical standard state, or both
a. ΔG (Some text use ΔG)
b. ΔG
c. Temperature is 25
d. Constant value of Mg2+
e. PH7
f. Intial concntration of reactants and products is 1M
g. Presurre is 1 atm.
Answer:
The conditions for biochemical, chemical and both standard states are shown below
Explanation:
Chemical standard state:
Temperature is 25°
Intial concntration of reactants and products is 1M
g. Presurre is 1 atm.
PH7
Biochemical standard state:
Temperature is 25°
PH7
Constant value of Mg2+
Both:
Intial concntration of reactants and products is 1M
g. Presurre is 1 atm.
Temperature is 25°
PH7
A geologic process is
A. the solid part of a rocky planet.
B.a feature that forms on the surface of a planet.
C. a long, narrow groove that forms where water, lava, or other liquid flows.
D. a long, narrow groove that forms where water, lava, or other liquid flows.
Answer:
The physical and human forces that work in combination to form and transform the world, for example, erosion, the water cycle, migration or urbanisation. Geographical processes can operate within and between places.
Many people are against the use of nuclear power plants because of the risk of meltdown, earthquakes, and tsunamis.
However, some groups still argue that nuclear power plants are worth the risk.
What is a positive effect of nuclear power plants?
A. Energy can be generated without risking the safety of plant employees.
B. The waste from these plants is used to produce space station materials.
C. The waste from these plants is safe, and its storage and disposal are simple.
D. Energy can be generated without burning fossil fuels.
Answer: Option C.
The waste from these plants is safe, and its storage and disposal are simple
Explanation:
Nuclear power plants produce waste when producing electricity and these waste are not really harmful as you think, they are stored well before disposing appropriately.
Once the waste is removed the reactor, the wastes are cool down in storage pool, they are moved to dry caske which is a concrete storage and stores it for a long time and can be dispose until the site is available for it.
What percentage of Americans believes that humans are causing global warming?
10
24
68
93
Answer:
49% say human activitiy contributes global warming.
Answer:
The answer is 68%
Explanation:
including me :)
Find the empirical formula of copper oxide.
Answer:
The empirical formula of the oxide is CuO
Explanation:
Copper(II) oxide or cupric oxide is the inorganic compound with the formula CuO
what mass of glucose c6h12o6 would be required to prepare 5000 mL of a 0.215 M solution
Approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M.
To determine the mass of glucose (C6H12O6) required to prepare a 0.215 M solution in 5000 mL, we need to use the formula:
Molarity (M) = moles of solute / volume of solution (in liters)
First, let's convert the volume of the solution from milliliters (mL) to liters (L):
5000 mL = 5000/1000 = 5 L
Now, we can rearrange the formula to solve for moles of solute:
moles of solute = Molarity (M) x volume of solution (L)
moles of solute = 0.215 M x 5 Lmoles of solute = 1.075 mol
Since glucose (C6H12O6) has a molar mass of approximately 180.16 g/mol, we can calculate the mass of glucose using the equation:
mass of solute = moles of solute x molar mass of solute
mass of glucose = 1.075 mol x 180.16 g/mol
mass of glucose = 194.0 g (rounded to three significant figures)
Therefore, approximately 194.0 grams of glucose (C6H12O6) would be required to prepare a 5000 mL solution with a concentration of 0.215 M. It's important to note that the molar mass of glucose used in this calculation may vary slightly depending on the level of precision required.
For more such questions on glucose visit:
https://brainly.com/question/397060
#SPJ8
Suppose that 25,0 mL of a gas at 725 mmHg and 298K is converted to
273'K and 760 mmHg atm. What would be the new volume? Hinto use the
following gas law equation (p1"V1) /T1 = (p2*V2)/72 "SHOW WORK *
28.15 ml
25.18 ml
21.85 mL
Particles of a liquid"
The new volume : 21.85 ml
Further explanationGiven
V1=25,0 ml
P1=725 mmHg
T1=298K is converted to
T2=273'K
P2=760 mmHg atm
Required
V2
Solution
Combined gas law :
\(\tt \dfrac{P_1.V_1}{T_1}=\dfrac{P_2.V_2}{T_2}\)
Input the value :
V2=(P1.V1.T2)/(P2.T1)
V2=(725 x 25 ml x 273)/(760 x 298)
V2=21.85 ml
Individual Laboratory Follow-up Questions a. Explain the purpose of the experiment. b. What are reasonable sources of error for determining calcium ion concentration by the titration process? c. Summarize the conclusions for your experiment in two to three complete sentences. Include the amount of calcium in your soil.
Solution :
a). In this experiments, we can determine the hardness of the water or \($Ca^{2+}$\) ion concentration in the sample.
b). The Possible errors are :
- During the weighing of calcium standard preparation, if the balance is not traced properly, it will cause an error.
- By dilution of standard from the stock will lead a dilution error of 0.1 mL for 100 mL.
- Misreading the liter values will give an error.
c). Depending upon the calcium content present in the soil, we conclude that the fertile percent of the soil as well as the mineral capacity of the soil.
This time, include both the coefficient and exponent. Express 0.00212 in scientific notation.
[?] * times 10^[?]
Enter the coefficient in the green box and the exponent in the yellow box.
Coefficient (green) Exponent (yellow)
_______________ _____________ Enter
Answer: 212
Explanation:
Determine the [H+] , [OH−], and pOH of a solution with a pH of 7.41
at 25 °C. [H+]=
M
[OH−]=
M
pOH=
Answer:
Explanation:
H+ = 1 X 10^-7.41 = 3.89 X 10^ -8
POH = 14-7.41 = 6.59
OH- = 1 x 10 ^-6.59 = 2.57 X 10^ -7
The [H+] and [OH−] concentrations of the solution are approximately 2.38 × 10^(-7) M, and the pOH is 6.59.
The pH of a solution is a measure of the concentration of hydrogen ions ([H+]) in the solution. The pH scale ranges from 0 to 14, with a pH of 7 considered neutral. A pH of 7.41 indicates that the solution is slightly basic. To calculate the [H+], [OH−], and pOH of the solution, we can use the relationship:
pH + pOH = 14
Given that the pH is 7.41, we can subtract it from 14 to find the pOH:
pOH = 14 - 7.41 = 6.59
Since pH + pOH = 14, we can also determine the [OH−] by taking the antilogarithm of the pOH value:
[OH−] = 10^(-pOH)
[OH−] = 10^(-6.59)
[OH−] ≈ 2.38 × 10^(-7) M
Since the solution is neutral, the concentration of [H+] will be equal to the concentration of [OH−]:
[H+] = [OH−] ≈ 2.38 × 10^(-7) M
Therefore, the [H+] and [OH−] concentrations of the solution are approximately 2.38 × 10^(-7) M, and the pOH is 6.59.
For more question on concentrations
https://brainly.com/question/30766678
#SPJ11
Question 1
This diagram shows Earth in four different positions during its yearly orbit around the sun. Which of the following accurately describes the position of the United States during the summer months?
Question 2
The diagram models 4 lunar phases. During which one is the tide the highest?
Question 3
An HR Diagram is shown below. A star that has a luminosity of 10^-2 is likely a…
Question 4
Earth's atmosphere blocks short wavelengths of the electromagnetic spectrum. Which telescopes DO NOT need to be placed in orbit around Earth to observe short-length radiation?
Question 5
A student models the relationship between the Earth and the Sun using string and a ball. Which of the following explains the relationship demonstrated?
Answer 1:
During the summer months in the northern hemisphere (where the United States is located), Earth is in position C, which is when the northern hemisphere is tilted towards the sun.
Answer 2:
The highest tide occurs during the full moon phase, which is represented by position C in the diagram.
Answer 3:
A star that has a luminosity of 10^-2 is likely a red dwarf.
Answer 4:
Telescopes that observe short-wavelength radiation, such as X-rays and gamma rays, do not need to be placed in orbit around Earth because these wavelengths are absorbed by the atmosphere. Therefore, telescopes that observe these wavelengths are typically placed in space, outside of Earth's atmosphere.
Answer 5:
The student is likely demonstrating the relationship between the Earth and the Sun's gravitational pull. The ball represents the Sun, and the string represents the gravitational force pulling the Earth towards the Sun. The demonstration shows how the Earth orbits the Sun due to this gravitational force.
What is gravitational force?Gravitational force is described as a force that exists between any two objects in the universe that have mass.
It is the force that causes objects with mass to be attracted to each other. The magnitude of the gravitational force between two objects depends on their masses and the distance between them.
Along with the electromagnetic force, the strong nuclear force, and the weak nuclear force, gravity is one of the four fundamental forces of the universe.
Sir Isaac Newton initially introduced it in his law of universal gravitation, and Albert Einstein later elaborated on it in his theory of general relativity.
Learn more about Gravitational force at: https://brainly.com/question/27943482
#SPJ1
Classify each reactant and product in this reaction as an acid or base according to the Brønsted theory.
HF + H2O = F + H30+
Answer Bank
HF
H30+
F-
H2O
Answer:
Reaction: \(\rm HF + H_2O \rightleftharpoons F^{-} + H_3O^{+}\).
\(\rm HF\): Bronsted-Lowry Acid.\(\rm H_3O^{+}\): Bronsted-Lowry conjugate Acid of \(\rm F^{-}\): Bronsted-Lowry conjugate Base of \(\rm HF\).\(\rm H_2O\): Bronsted-Lowry Base.Explanation:
In the Bronsted-Lowry acid-base theory, the acid in a reaction is the species that loses a proton, \(\rm H^{+}\). The resultant species would be the conjugate base of that acid.
On the other hand, the Bronsted-Lowry base in a reaction is the species that accepts a proton \(\rm H^{+}\). The resultant species would be the conjugate acid of that base.
Identify the conjugate acid-base pairs in this reaction. Note that the two species in each pair are related by the gain or loss of a single proton. Therefore, their formula should look similar to each other.
For this reaction, \(\rm HF\) and \(\rm F^{-}\), as well as \(\rm H_2O\) and \(\rm H_3O^{+}\) form two similar-looking reactant-product pairs:
The reactant \(\rm HF\) loses one proton to form the product \(\rm F^{-}\). Therefore, \(\rm HF\!\) would be the Bronsted-Lowry acid, while \(\rm F^{-}\!\) would be its conjugate base.The reactant \(\rm H_2O\) gains one proton to form the product \(\rm H_3O^{+}\). Therefore, \(\rm H_2O\!\) would be the Bronsted-Lowry base, while \(\rm H_3O^{+}\!\) would be the conjugate acid.