2. The transfer of heat by direct contact. What kind of heat transfer is this an example of? ​

Strong bonds between the atoms are shown by the high melting and boiling temperatures of metals.

The coordination number for each atom is either eight or twelve, and metallic solids contain metal atoms arranged in face-centered or body-centered patterns. The difficulty is that the bonding is too strong for London Dispersion forces, in addition to the fact that there are insufficient electrons to form covalent bonds. The problem is solved by the fact that the nuclei of the metals float in a sea of electrons. Metals transmit electricity because the electrons are mobile and delocalized.

To know more about metals click on the link below:

https://brainly.com/question/4701542

#SPJ4

Answer:

Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO

Explanation:

The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.

The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.

The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.

The methyl groups are non-polar and do not have any significant reactivity.

The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.

The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.

The diffusion coefficient (D) of a species can be calculated using the Arrhenius equation: D = D0 * exp(-Q/RT)

Where D0 is the pre-exponential factor, Q is the activation energy, R is the gas constant, and T is the temperature in Kelvin. For the diffusion of hydrogen through BCC iron, the activation energy is typically in the range of 85-105 kJ/mol. Using Q = 100 kJ/mol and T = 298 K (25°C), we can estimate D = \(2.2 * 10^-14 cm^2/s\). For the diffusion of H into Al, we already know D0 =\(0.11 cm^2/s\)and Q = 9780 cal/mol. Converting Q to kJ/mol, we have Q = 40.8 kJ/mol. Using this value and T = 298 K, we can estimate D = \(7.3 * 10^-15 cm^2/s\). Based on these calculations, it is apparent that BCC iron would be better suited as the material for a high-pressure hydrogen storage tank due to its higher diffusion coefficient. The slower diffusion of hydrogen through aluminum would result in a lower rate of hydrogen uptake, making it a less suitable material for hydrogen storage applications.

The complete question is:

Calculate the diffusion coefficients for the diffusion of hydrogen through BCC iron and FCC aluminum at room temperature (25°C). For the diffusion of H into Al, D0 = 0.11 cm2/s and Q = 9780 cal/mol. Based on your calculations, which material would be better suited as the material for a high-pressure hydrogen storage tank?

Learn more about hydrogen  here:

https://brainly.com/question/28060590

#SPJ4

Answer: An electron con only exist in a limited number of quantized energy levels.

Explanation:

Answer:

4 millllllermeeters jb

The molarity of the aqueous solution is determined as 0.72 M NaOH.

Molarity is used to express the concentration of a solution. It is described as the number of moles of a solute in a given concentration of a solution.

Mathematically, molarity is given as;

M = n/V

where;

The volume of the water is calculated as follows;

volume = mass / density

volume = (5 kg) / (1000 kg/m³)

volume = 0.005 m³

The volume of the water in liters is calculated as follows;

volume = 0.005 m³ = 5 liters

The given parameters;

number of moles of the solute = 3.6 moles

Molarity = 3.6 moles / 5 L

molarity = 0.72 M

Thus, the molarity of the aqueous solution of sodium hydroxide is determined from the ratio of number of moles to the volume of the solution.

Learn more about molarity here: https://brainly.com/question/14469428

#SPJ1

Answer:

a. c= silver/ 234J(kg/K) > b. c= water/ 4190 J(kg/K) > c. c= glass/ 754J/(kg.K)

Explanation:

Hello.

In this case, since the heat resulting from the temperature change for an specified amount of a substance is defined via:

\(Q=mCp\Delta T\)

Since the specific heat is related to amount of energy required to raise the temperature of 1 kg of a substance by 1 °C, we can infer that the higher the specific heat, the higher the required energy as they are in a directly proportional relationship. Moreover, since the specific heat and the change in temperature are in an inversely proportional relationship, we can infer that the higher the specific heat, the lower the temperature change, therefore, we can rank the substances follows:

a. c= silver/ 234J(kg/K) > b. c= water/ 4190 J(kg/K) > c. c= glass/ 754J/(kg.K)

It means that silver will produce the largest temperature change, next water and finally glass since silver has the smallest specific heat next water and finally glass.

Best regards.

Answer:

he discovered positively charged nucleus

Answer:

C

Explanation:

because then you'd be able to make a group to raid, run with you, and save more people.

can i please get brainlyest

"the view or belief that the rights and needs of humans are not more important than those of other living things."

Answer:

the view or belief that the rights and needs of humans are not more important than those of other living things.

explanation:

The strand 1 of hydrocarbons is used to produce plastic, hence option D is correct.

Raw resources like natural gas, oil, or plants that have been processed into ethane and propane are used to make plastics. The subsequent "cracking" procedure uses heat to transform ethane and propane into ethylene and propylene. To produce various polymers, these components are mixed.

Propylene is a substance found in large quantities in petroleum. In order to speed up chemical processes, refiners combine heated propylene with a catalyst to create plastic. Propylene molecules start to cluster together like beads on a thread as a result.

Learn more about plastic, here:

https://brainly.com/question/28420086

#SPJ1

Answer: 22.4 L at STP to figure out the volume of the oxygen in this question at STP. The answer is 0.338 L (338 mL)

Explanation:but you will have to show the calculations to receive credit on your lab report. What is the density of air at STP? 1.225 kg/m^3 In Metric units: 1.225 kg/m^3.

Answer:

400.0°F is equal to 204.44°C in standard notation.

Explanation:

To convert from Fahrenheit (°F) to Celsius (°C), we can use the following formula:

T(°C) = (T(°F) - 32) × 5/9

where T(°F) is the temperature in Fahrenheit and T(°C) is the temperature in Celsius.

Substituting T(°F) = 400.0 into the formula, we get:

T(°C) = (400.0 - 32) × 5/9

T(°C) = (368.0) × 5/9

T(°C) = 204.44

Therefore, 400.0°F is equal to 204.44°C in standard notation.

The term that refers to the passing of a wave through an object is "transmission."

Transmission refers to the process by which a wave passes through an object or medium. In the context of sound, transmission occurs when sound waves travel through different substances, such as air, water, or solids.

When a sound wave encounters an object, it can be transmitted through it, reflected off it, or absorbed by it, depending on the properties of the object and the medium through which the sound is traveling.

For example, when you speak into a microphone, the sound waves produced by your voice travel through the air and are transmitted to the microphone's diaphragm. The diaphragm converts the sound waves into electrical signals, which can then be amplified and reproduced as sound through speakers.

In summary, transmission is the term used to describe the passage of a wave, such as a sound wave, through an object or medium. It is an essential concept in understanding how waves interact with their surroundings and how sound propagates through different materials.

for such more questions on  transmission

https://brainly.com/question/18451537

#SPJ8

Taking into account the change of units, 21.8 in³ is equal to 0.357238 L.

The rule of three is a way of solving problems of proportionality between three known values and an unknown value, establishing a relationship of proportionality between all of them.

If the relationship between the magnitudes is direct, that is, when one magnitude increases, so does the other (or when one magnitude decreases, so does the other) , the direct rule of three must be applied using the following formula, where a, b and c known data and x the variable to be calculated:

a ⇒ b

c ⇒ x

So: x= (c×b)÷ a

The direct rule of three is the rule applied in this case where there is a change of units.

To perform in this case the conversion of units, you must first know that 1 in³ = 0.0163871 L. So, the rule of three can be used as follow: if 1 in³ is 0.0163871 L, 21.8 in³ equals how many L?

1 in³ ⇒ 0.0163871 L

21.8 in³ ⇒ x

So: x= (21.8 in³ ×0.0163871 L)÷ 1 in³

Solving:

x= 0.357238 L

In summary, 21.8 in³ is equal to 0.357238 L.

Learn more with this example:

brainly.com/question/12482948

#SPJ1

The percent yield of \(Fe_2O_3\)  if 57.8g was collected is 75.1%.

To calculate the percent yield, we need to compare the actual yield (the amount of\(Fe_2O_3\) collected) to the theoretical yield (the amount of \(Fe_2O_3\)that would be obtained if the reaction went to completion).

First, we need to determine the molar mass of \(Fe_2O_3\) and \(Fe_2S_3\):

Molar mass of \(Fe_2O_3\):

2(55.85 g/mol) + 3(16.00 g/mol) = 159.69 g/mol

Molar mass of\(Fe_2S_3\):

2(55.85 g/mol) + 3(32.07 g/mol) = 207.67 g/mol

Next, we can calculate the theoretical yield of\(Fe_2O_3\) using stoichiometry:

2 moles of \(Fe_2S_3\) produce 2 moles of \(Fe_2O_3\)(according to the balanced equation).

So, the molar ratio of \(Fe_2O_3\)to Fe2S3 is 2:2.

The molar mass ratio of \(Fe_2O_3\) to Fe2S3 is:

159.69 g/mol : 207.67 g/mol

To calculate the theoretical yield, we can use the following equation:

Theoretical yield of\(Fe_2O_3\) = (mass of \(Fe_2S_3\)) * (molar mass of \(Fe_2O_3\) / molar mass of \(Fe_2S_3\))

Theoretical yield of \(Fe_2O_3\) = (100.0 g) * (159.69 g/mol / 207.67 g/mol)

Theoretical yield of \(Fe_2O_3\) = 76.46 g

Now we can calculate the percent yield using the formula:

Percent yield = (actual yield / theoretical yield) * 100

Percent yield = (57.8 g / 76.46 g) * 100

Percent yield = 75.1%

Therefore, the percent yield of \(Fe_2O_3\) is 75.1%.

Know more about  percent yield    here:

https://brainly.com/question/2451706

#SPJ8

Answer: I already gave u the aNswer

Explanation:0  ok bye

bye .................................

Answer:

Erosion can happen very quickly or very slowly.

e.g splash erosion occurs slowly while gulley erosion occurs very fast.

The volume of the blood sample is 5mL

HOW TO CALCULATE VOLUME:

Density = mass ÷ volume

Volume = mass ÷ density

Volume = 5.25 ÷ 1.05

Volume = 5mL

The The volume of the blood sample is 5mL.

Learn more: https://brainly.com/question/6034174?referrer=searchResults

Due to the trend of boiling points, the optimal order for elements within a group going from top to bottom is \(A, X_o, Z_w\).

From the given information we can see that the boiling points of the elements decrease from A to Xo to Zw. The highest boiling point (350°C) is of element A, followed by Xo (215°C) and Zw (285°C). We arrange the components in decreasing order of boiling points to get A, Xo and Zw.

It is important to remember that in this situation, the alphabetical order of the elements and their atomic weights are irrelevant considerations. A reasonable basis for arranging the components within the system is provided by the trend in boiling points.

Learn more about boiling points, here:

https://brainly.com/question/1416592

#SPJ1

This atom has a mass number of 195. Hence, there are 78 protons in an atom, which is the atomic number.

Atoms that belong to the same element with the same isotopes Z but a distinct mass number A are known as isotopes. Carbon-12, Carbon-13, while Carbon-14 are three isotopes of the element carbon, each with a mass of 12, 13, and 14.

Atoms that belong to the same element with an identical electron density Z but a distinct mass number A are known as isotopes. For instance, carbon-12, carbon-13, or carbon-14 are three isotopes of the crystal structures, with corresponding weights of 12, 13, and 14.

To know more about isotope visit:

brainly.com/question/1983121

#SPJ1

Answer:

Harry, for sure.

Explanation:

Answer: Most people would say Harry, I'm guessing.

Explanation:

Answer:

mass of chlorine gas required is 118 kg.

Explanation:

Total mass of the drug (Cisplatin) required = 500 kg

For the drug PtCl2(NH3)2, we first find the molar mass of the compound.

The molar mass of the drug is the total of all the molar mass of the elements in the drug

molar mass of Pt (platinum) in the drug = 195.078 g/mol

molar mass of chlorine (Cl) in the drug = 2 x (35.453 g/mol) = 70.908 g/mol

molar mass of ammonia (NH3) in the drug = 2 x (17.031 g/mol) = 34.062 g/mol

Total molar mass of the drug = 195.078 g/mol + 70.908 g/mol + 34.062 g/mol = 300.048 g/mol

fractional composition of chlorine in the drug = 70.908/300.048 = 0.236

mass of chlorine required for 500 kg of the drug = 0.236 x 500 = 118 kg

Answer:

7.0k x 10^2k

Explanation:

Answer:

the answer i believe is increased nutritional value of crops

Explanation:

Answer: increased nutritional value of crops

Explanation:) edge 2022

Glycolysis and photosynthesis are fundamental processes that are necessary for the survival of living organisms. They are similar in that they both involve the conversion of energy, but differ in the source of energy used, the location of the process, and the requirement for oxygen.

Glycolysis and photosynthesis are two necessary fundamental processes. Glycolysis is a metabolic pathway that occurs in the cytoplasm of cells. The glycolysis process is necessary because it produces ATP, which is the energy required for all cellular activities.

The energy is produced by breaking down glucose into two pyruvate molecules.Photosynthesis is the process by which green plants make their food. During photosynthesis, light energy is converted into chemical energy, which is stored in glucose molecules. This process is also necessary as it provides food and oxygen for most living organisms to survive.In terms of similarities, both glycolysis and photosynthesis are processes that involve the conversion of energy.

In glycolysis, glucose is converted into pyruvate and ATP, while in photosynthesis, light energy is converted into chemical energy. Both processes are also vital to the survival of living organisms.The primary difference between the two processes is the source of energy used. Glycolysis uses glucose as the primary energy source while photosynthesis uses light energy from the sun.

Glycolysis occurs in the cytoplasm of cells while photosynthesis takes place in the chloroplasts of plant cells. Glycolysis is an anaerobic process that does not require oxygen, while photosynthesis is an aerobic process that requires oxygen and releases it as a byproduct.

for more such questions on conversion of energy

https://brainly.com/question/15105485

#SPJ8

Answer:35.437 mL

Explanation:

Combined gas law

P1V1/T1 = P2V2/T2

P1= 475 torr

V1= 54 mL

T1= 260.15 Kelvin

T2= 273.15 Kelvine

P2= 760 torr

V2=  

V2=P1V1T2/(T1P2) m

V2= 475 X 54 X 273.15 / (260.15 X 760) =35.437 mL

Answer:

I think it was when she caught him talking to his "child"