1. Find k, the constant of proportionality, for the given graph.

2. Write an equation of the form y = kx for the relationship shown in the graph.

1. Find K, The Constant Of Proportionality, For The Given Graph.2. Write An Equation Of The Form Y =

Answers

Answer 1

Answer:

The answer is B or 15.

Step-by-step explanation:

the total money saved divided by the time is always 15


Related Questions

3 points
A rectangular prism and a cylinder have the same height. The length of each side of the prism base is equal to the diameter of the cylinder. Which shape has a greater
volume? Use the drop-down menus to explain your answer.
Volume of a Rectangular Prism: V = lwh
Volume of a Cylinder: V = ²h
✓has the greater volume because the choose your answer... V
The choose your answer...
extra space between the two figures.
fits within the
choose your answer....
with

Answers

The rectangular prism has a greater volume than the Cylinder.

Since the rectangular prism has a greater volume than the cylinder because the rectangular prism fully occupies the space within its boundaries, while the cylinder has empty space above and below it.

The cylinder is rounded shape leaves gaps between its curved surface and the boundaries of the rectangular prism.

Therefore, the rectangular prism could hold more volume than the cylinder as it utilizes the entire space within its shape efficiently.

More on the volume of shapes can be found here: brainly.com/question/28641737

#SPJ1

How many three-digit counting numbers are not multiples of ​5?

Answers

Answer:There are 720 3-digit numbers that are not multiples of 5.

Step-by-step explanation:

Stanford University conducted a study of whether running is healthy for men and women over age 50. During the first eight years of the study, 1.5% of the 451 members of the 50-Plus Fitness Association died. We are interested in the proportion of people over 50 who ran and died in the same eight-year period.
a. Define the random variables X and P′ in words.
b. Which distribution should you use for this problem? Explain your choice.
c. Construct a 97% confidence interval for the population proportion of people over 50 who ran and died in the same eight–year period.
i. State the confidence interval.
ii. Sketch the graph.
iii. Calculate the error bound.
d. Explain what a "97% confidence interval" means for this study.

Answers

a. The random variable X represents the number of people over 50 who ran and died in the same eight-year period.

b. The appropriate distribution for this problem is the binomial distribution, which describes the number of successes.

c. The 97% confidence interval for the population proportion of people over 50 who ran and died in the same eight-year period is (0.0206, 0.1149).

d. The true population proportion lies within this interval, nor does it mean that the observed proportion (0.0677) has a 97% chance of being correct.

a. The random variable X represents the number of people over 50 who ran and died in the same eight-year period. The population proportion of over-50s who ran and passed away within the same eight-year period is represented by the random variable P'.

b. The appropriate distribution for this problem is the binomial distribution, which describes the number of successes (in this case, people who ran and died) in a fixed number of independent trials (in this case, the population of people over 50 during the eight-year period), where the probability of success is constant for each trial.

c. To construct a 97% confidence interval for the population proportion of people over 50 who ran and died in the same eight-year period, we can use the following formula:

p^±zα/2p^(1p^)n

where \hat{p} is the sample proportion, n is the sample size, and zα/2 is the z-score associated with the desired level of confidence (97%, in this case).

Given that 1.5% of the 451 members of the 50-Plus Fitness Association died during the eight-year period, we can estimate the sample proportion as:

p^=Xn=0.015×4511=6.7650.0677

where X = 0.015×4517 is the observed number of people over 50 who ran and died in the same eight-year period.

Substituting the given values into the formula, we have:

0.0677±2.170.0677(10.0677)451(0.0206,0.1149)

Therefore, the 97% confidence interval for the population proportion of people over 50 who ran and died in the same eight-year period is (0.0206, 0.1149).

ii. The graph of the confidence interval would be a horizontal line segment between the two endpoints (0.0206, 0.1149) on the y-axis, with a vertical line at the midpoint (0.0677) on the x-axis.

iii. The error bound is:

zα/2p^(1p^)n0.0471

d. A "97% confidence interval" means that if we were to repeat this study many times, using different samples of the same size from the same population, we would expect the true population proportion of people over 50 who ran and died in the same eight-year period to be captured by the confidence interval in 97% of those repetitions. In other words, we are 97% confident that the true population proportion falls within the interval (0.0206, 0.1149). It does not mean that there is a 97% chance that the true population proportion lies within this interval, nor does it mean that the observed proportion (0.0677) has a 97% chance of being correct.

for such more question on proportion

https://brainly.com/question/19994681

#SPJ4

samantha mixes some amount of 25% sugar syrup with x grams of 10% sugar syrup. the result is120 grams 15% sugar syrup. how many grams of 25% sugar syrup did samantha use?

Answers

Answer:

Final mixture is 120 gm

x = 10%      then   (120-x) = 25%

.25(120-x)    + .1 (x)    =  .15 (120)       solve for x= 10% amount

                                                                 then  25% amount = 120-x

Step-by-step explanation:

Choose the pythagorian triplet with the smallest number as 10.

a) 24, 26, 10
b) 10, 6, 8
c) 10, 16, 18
d) 10, 18, 20​

Answers

Answer:

b

Step-by-step explanation:

pls give brainliest hope helpful

How many gallons of a 50​% antifreeze solution must be mixed with 70 gallons of ​10% antifreeze to get a mixture that is 40​% ​antifreeze?

Answers

Answer: 180 gallons needed

Step-by-step explanation:

Zykeith,

Assume x gallons of 50% antifreeze is needed

Final mixture is x + 60 gallons

Amount of antifreeze in mixture is 0.4*(x+60)

Amount of antifreeze added is .5x + .1*60 = .5x + 6

so .5x + 6 = .4(x + 60)

.5x -.4x = 24 -6

.1x = 18

x = 180

SOLUTION:

Let x be the number of gallons of the 50% antifreeze solution needed. We know that the resulting mixture will be 70 + x gallons. To get a 40% antifreeze mixture, we can set up the following equation:

0.5x+0.1(70)=0.4(70+x)

Simplifying the equation:

0.5x+7=28+0.4x

0.1x=21

\boldx=210

We need 210 gallons of the 50% antifreeze solution to mix with 70 gallons of 10% antifreeze to get a mixture that is 40% antifreeze.

\blue

factorise x³-4x²+x+6​

Answers

The binomial factors of x³- 4x²+x+6​ are (x+2), (x+3), and (x-1).

Using the splitting and grouping the terms:

x³ + 4x² + x - 6

= x³ + 2x² + 2x² + x - 6  [Splitting 4x² = 2x² + 2x²]

= (x³ + 2x²) + (2x² + x - 6)

= x² (x + 2) + (2x² + 4x - 3x - 6)

= x² (x + 2) + [ 2x (x + 2) - 3 (x + 2)]

= x² (x + 2) + (x + 2) (2x - 3)

= (x + 2) ( x² + 2x - 3)

= (x + 2) ( x² + 3x - x - 3)

= (x + 2) [x (x + 3) - 1 (x + 3)]

= (x + 2) (x + 3) (x - 1)

Hence, the binomial factors are (x + 2), (x + 3) and (x - 1)

To learn more about factorise here,

https://brainly.com/question/10718512

https://brainly.com/question/24734894

Find the square root of: 2 + sqrt5

Answers

Answer:

3.65

Step-by-step explanation:

The square root of 2 is 1.4 and the square root of 5 is 2.2 adding that together you get 3.6

Solve the equation for the indicated variable. SHOW ALL WORK!

ab-ac=2 solve for a

Answers

Answer:

a= 2/b-c

Step-by-step explanation:

We want isolate for a or to be itself

ab-ac=2

factor out a

a (b-c)=2

Now bring b-c to the other side

a (b-c)/(b-c)=2/b-c

The b-c cancel each other out

a= 2/(b-c)

Comparing Rates of Change Station Cards
(y=mx+b form)
Write a function rule that has a rate of change greater than the function
that passes through the points given in the table.
-2
-1
0
1
2
7
1
-2
-5

Answers

Answer: y = -4x + 1. Brainliest?

Step-by-step explanation:

To write a function rule that has a greater rate of change than the given function, we need to find the slope of the given function. We can use the two points (-2, 7) and (2, -5) from the table to calculate the slope as:

slope = (change in y) / (change in x) = (-5 - 7) / (2 - (-2)) = -3

So the slope of the given function is -3. To create a new function rule with a greater rate of change, we can choose a larger slope. Let's choose a slope of -4. We also need to find the y-intercept (b) of the new function, which we can do by plugging in one of the points from the table and solving for b. Let's use the point (0, 1):

y = mx + b

1 = (-4)(0) + b

b = 1

So the function rule with a greater rate of change and passing through the point (0, 1) is:

y = -4x + 1

Please help and explain

Please help and explain

Answers

Answer:

=x123y4

Step-by-step explanation:

=x123y4

Using sine tule find Obtuse angle B

Using sine tule find Obtuse angle B

Answers

Law of sinessin(A)a=sin(B)b=sin(C)c \dotfillsin(B)7=sin(30o)6sin(B)=7sin(30o)6B=sin1[7sin(30o)6]B35.69o

Make sure your calculator is in Degree mode.

Thompson and Thompson is a steel bolts manufacturing company. Their current steel bolts have a mean diameter of 145145 millimeters, and a standard deviation of 77 millimeters. If a random sample of 3131 steel bolts is selected, what is the probability that the sample mean would differ from the population mean by greater than 33 millimeters

Answers

Answer:

The probability that the sample mean would differ from the population mean by greater than 33 millimeters is 0.0174

Step-by-step explanation:

Mean=μ=145mm

Standard deviation =σ=7

We are supposed to find the probability that the sample mean would differ from the population mean by greater than 3 millimeters

P(|xμ|>33)=1P(|xμ|<3)P(|xμ|>33)=1P(3<|xμ|<3)P(|xμ|>33)=1P(3σn<|xμ|σn<3σn)P(|xμ|>33)=1P(3731<|xμ|σn<3731)P(|xμ|>33)=1P(2.38<z<2.38)P(|xμ|>33)=1(P(z<2.38)P(z<2.38))

Using Z table

                   = 1-(0.9913-0.0087)

                  =0.0174

Hence  the probability that the sample mean would differ from the population mean by greater than 33 millimeters is 0.0174

Solve the following proportion for v

3/13=v/10

Round your answer to the nearest tenth.

V=?

Answers

Answer:

the answer is 0

Step-by-step explanation:

in a video game clare
score 50 more points than Tyler if c is the number of points that clear score and tease the number of points that Tyler score which equations are correct select all that apply

C=1.5t C=t+0.5 C=t+0.5t C=(1+0.5)t C=t+50

Answers

Answer:  C=t+50

Step-by-step explanation: This equation means that Clare's score equals Tyler's score plus 50.

Only one choice is correct here.

3(2x-5) + x/4 When x=8

x/4 is fraction

Answers

As a result, for x=8, 3(2x-5) + x/4 equals 35 as we  substitute 8 for x and simplify to evaluate the expression 3(2x-5) + x/4.

what is fraction ?

A fraction is a ratio of a whole or its component parts expressed numerically. It is written as two integers stacked one on top of the other, separated by a fraction bar—a horizontal line. The numerator is the number above the fraction bar, while the denominator is the number below the fraction bar. For instance, the fraction 3/4 denotes three of a whole's four equal pieces. The denominator (4) represents all of the equally sized components that make up the whole, while the numerator (3) denotes the number of parts that are being taken into consideration.

given

For x=8, we substitute 8 for x and simplify to evaluate the expression 3(2x-5) + x/4:

3(2x-5) + x/4 = 3(2(8)-5) + 8/4

= 3(16-5) + 2

= 3(11) + 2

= 33 + 2

= 35

As a result, for x=8, 3(2x-5) + x/4 equals 35 as we  substitute 8 for x and simplify to evaluate the expression 3(2x-5) + x/4.

To know more about fraction visit:

https://brainly.com/question/10354322

#SPJ1

Which method is the best method for solving the equation?
8x213x+3=0

Answers

Answer:

Step-by-step explanation:

Which Method Should Be Used to Solve a Quadratic Equation? Quadratic equations are of the form ax2 + bx + c = 0 where a, b and c are real numbers, a ≠ 0. Quadratic equations have two solutions, but it is possible that one solution may repeat. happy to help

Write two different expressions you could use to represent the
combined area of the Activities and Quotations sections. What
information about the sections does each expression show?

Answers

The area expressions are (2x + 1) * (x^2 + 4x - 5) and 2x^3 + 9x^2 - 6x - 5

How to determine the area expressions

The missing figure is added as an attachment

From the question, we have the following parameters that can be used in our computation:

Length = 2x + 1

Width =  x^2 + 4x - 5

The area is calculated as

Area = (2x + 1) * (x^2 + 4x - 5)

When expanded, we have

Area = 2x^3 + 8x^2  -10x + x^2 + 4x - 5

Evaluate the like terms

Area = 2x^3 + 9x^2 - 6x - 5

Hence, the area expression is 2x^3 + 9x^2 - 6x - 5

Read more about polynomial at

https://brainly.com/question/7693326

#SPJ1

Write two different expressions you could use to represent thecombined area of the Activities and Quotations

Pls figure out the question

Pls figure out the question

Answers

Answer:

w=2

Step-by-step explanation:

Step-by-step explanation:

first simplified by dividing both sides by -5.

then, at

w - 5 = -3

add 5 to both sides.

and we get

w = 2

Given that X (9,8) was rotated clockwise a number of degree to become X'(8,-9)

Answers

Consider that a rotation of 90° consists:

T(x,y) = > T'(y,-x)

you can notice that the rotation X(9,8) => X'(8,-9) is preciselly a rotation of 90°.

90°

officials begin to release water from a man made lake at a rate that would empty the lake in 16 weeks, but a river that can fill the lake in 30 weeks is replenishing the lake at the same time. how many weeks does it take to empty the lake? express you answer as a fraction reduced to the lowest terms, if needed.​

Answers

Answer:

34²/7

Step-by-step explanation:

Take the dam to be a take and the exit of the dam to be a tap at the bottom which is used to empty the tank and the river to be a pipe at the top of the tank that is used to fill the tank

The tap takes 16 week to empty the tank how much will it empty in 1 week =¹/16

The pipe takes 30 week to fill the tank how much will it fill in 1 week =¹/30

¹/16-¹/30= ?

Get the LCM of the denominator which is 240

The fractions are now

15/240-⁸/240=⁷/240

1week=⁷/240 empty

? = 240/240 empty

Cross multiple

240/240×1÷7/240

240/240×1÷240/7=240/7

7÷240=34²/7 weeks

f(x)=2x1 + 16x2 + 7x3 + 4x4 -> min

Answers

Step-by-step explanation:

f(x)=(2x-1)square=0

it can be 0 or greater than 0

Hence,maximum value of (2x- 1)square=0

maximum value of (2x- 1square)+3=0+3=3

Please help I will brainliest!! Really urgent!!

Find the difference

and tell you me how you go it, not just the answer please!❤️

Please help I will brainliest!! Really urgent!! Find the difference and tell you me how you go it, not

Answers

Answer:

-2.83333333

Hope this helped!

Answer:

13x-1

Step-by-step explanation:

(56x-7)-(12x-6) =

The - sign before 6 is turned into a + sign when the bracket is removed because the arithmetic operation before the bracket is - and two - makes the second - turn into a + (It's a rule I can't rlly explain it well but yea)

56x-7-12x+6 = 56x-1-12x

-7+6 makes it a -1.

56x-12x-1 = 56x-36x-1

To make the denominator of the two fractions the same, I multiplied the second fraction by 3 so that both denominators are 6.

56x-36x-1 = 26x-1

After making the denominator the same, I can directly do the equation for the numerators (5-3=2) and keep the denominator the same.

26x-1 = 13x-1

Since 2/6 has a common factor which is 2, I can divide both the numerators and denominators so that the fraction can be simplified further into 1/3, its simplest form.

Find the population variance and standard deviation.
8​, 17​, 29​, 35​, 41

Answers

Answer:

53

Step-by-step explanation:

By taking the number "41" and minus it with "35" and you'll get 12. Take the number "12" and plus with "41" and you'll get the answer.

the population variance is 144 and the population standard deviation is 12.

To find the population variance and standard deviation for the given data set, follow these steps:

Step 1: Find the mean (average) of the data set.

Step 2: Subtract the mean from each data point to find the differences.

Step 3: Square each difference.

Step 4: Calculate the sum of the squared differences.

Step 5: Divide the sum of squared differences by the total number of data points to find the variance.

Step 6: Take the square root of the variance to find the standard deviation.

Given data set: 8, 17, 29, 35, 41

Step 1: Find the mean (average):

Mean = (8 + 17 + 29 + 35 + 41) / 5

Mean = 130 / 5

Mean = 26

Step 2: Find the differences from the mean:

Differences: (8 - 26) = -18, (17 - 26) = -9, (29 - 26) = 3, (35 - 26) = 9, (41 - 26) = 15

Step 3: Square each difference:

Squared differences: (18)2=324,(9)2=81,32=9,92=81,152=225

Step 4: Calculate the sum of squared differences:

Sum of squared differences = 324 + 81 + 9 + 81 + 225 = 720

Step 5: Calculate the variance:

Variance = Sum of squared differences / Number of data points

Variance = 720 / 5

Variance = 144

Step 6: Calculate the standard deviation:

Standard deviation = √Variance

Standard deviation = √144

Standard deviation = 12

So, the population variance is 144 and the population standard deviation is 12.

To know more about standard deviation:

https://brainly.com/question/32697343

#SPJ3

What is the value of the function y = 2x - 3 when x = -5?

A.-5

B.-13

C.2

D.3​

Answers

first thing you got to do is substitute x with -1 then you do the work first you got to know your order of operation which is PEMDAS what that stands for is perentice exponent multiplication division addition and subtraction so then what you do first is 2*-1+3 2*-1=-2+3=1 and that is the answer you are WELCOME.

The cost of producing higlighter​s with the company logo printed on them consists of a onetime setup fee of $160.00 plus $0.65 for each higlighter produced. This cost can be calculated using the formula C=160.00+0.65p, where p represents the number of higlighters produced and C is the cost. Use the formula to calculate the cost of producing 2400 higlighters. (Do not inlcude a comma in your answer)

Answers

Answer:

7839 ...........

Use the triangular prisons below to answer questions 6-9. Be sure to show all steps and work.

Use the triangular prisons below to answer questions 6-9. Be sure to show all steps and work.

Answers

The prism A have lateral surface area = 685 and total surface area = 1021, while the prism B have lateral surface area = 328 and total surface area = 448.

How to calculate for the lateral and total surface area of the triangular prisms

The triangular prisms A and B have two same size triangle faces and two different size rectangle face with a rectangle bottom face.

For 6 and 7;

area of one triangle face = 1/2 × 21 × 9

area of one triangle face = 94.5

area of the two triangle faces = 2(94.5) = 189

area of one smaller rectangle face = 16 × 14 = 224

area of one bigger rectangle face = 17 × 16 = 272

Area of lateral surface area = 188 + 224 + 272 = 685

Area of bottom rectangle face = 21 × 16 = 336

Total surface area of prism A = 685 + 336 = 1021

For 8 and 9;

area of one triangle face = 1/2 × 24 ×

area of one triangle face = 84

area of the two triangle faces = 2(84) = 168

area of one smaller rectangle face = 7 × 5 = 35

area of one bigger rectangle face = 25 × 5 = 125

Area of lateral surface area = 168 + 35 + 125 = 328

Area of bottom rectangle face = 24 × 5 = 120

Total surface area of prism A = 328 + 120 = 448

Therefore, the prism A have lateral surface area = 685 and total surface area = 1021, while the prism B have lateral surface area = 328 and total surface area = 448.

Read more about surface area here:https://brainly.com/question/12506372

#SPJ1

Banabas must pay his ex-wife an amount of R350 000 in two years’ time. Calculate the amount that he must invest today to have this amount available, assuming that Bank X offered him an in interest rate of 8.15% per annum compounded monthly.

Answers

Answer:

He must invest R297 521 today.

Step-by-step explanation:

The compound interest formula is given by:

A(t)=P(1+rn)nt

Where A(t) is the amount of money after t years, P is the principal(the initial sum of money), r is the interest rate(as a decimal value), n is the number of times that interest is compounded per year and t is the time in years for which the money is invested or borrowed.

Banabas must pay his ex-wife an amount of R350 000 in two years’ time.

This means that t=2,A(t)=350000

Interest rate of 8.15% per annum compounded monthly:

This means that r=0.0815,n=12.

Amount he must invest today:

This is P. So

A(t)=P(1+rn)nt

350000=P(1+0.081512)212

P=350000(1+0.081512)212

P=297521

He must invest R297 521 today.

PLZzzz help this is due today 10 points dont waste em plzz. What is the measure of angle x?
Enter your answer in the box.

x =
°

PLZzzz help this is due today 10 points dont waste em plzz. What is the measure of angle x?Enter your

Answers

Answer:

43

Step-by-step explanation:

the line is worth 180 degrees. subtract 90 and 47 because that is part of the 180. your left with 43 degrees which is what is missing. hope this helps!

7 7/8 - 3 1/4 =? What’s the answer

Answers

Answer:

4 5/8

Step-by-step explanation:

7 7/8= 63/8

3 1/4= 13/4= 26/8

63/8 - 26/8= 37/8

37/8= 4 5/8

Other Questions
Mary is solving the equation 3(x+4)= 7x-20. The first thing she does is rewrite the equation as shown below. 3x + 12 = 7x - 20 Which property did Mary use to get from the original equation to her rewritten equation? Adistributive property B associative property of multiplication C multiplicative property of equality D commutative property of multiplication A computer company produces affordable,easy-to use home computer systems and has fixed costs of $250. The marginal cost of producing computers is $700 for the first computer, $250 for the second, $300 for the third,$350 for the fourth,$400 for the fifth,$450 for the sixth, and $500 for the seventh.a. Create a table that shows the companys output, total cost, marginal cost, average cost, variable cost, and average variable cost.b. At what price is the zero-profit point? At what price is the shutdown point?c. If the company sells the computers for $500, is it making a profit or a loss? How big is the profit or loss? Sketch a graph with AC, MC, and AVC curves to illustrate your answer and show the profit or loss.d. If the firm sells the computers for $300, is it making a profit or a loss? How big is the profit or loss? Sketch a graph with AC, MC, and AVC curves to illustrate your answer and show the profit or loss. what did the constitution replace as our governing document in the united states? Ukraine occupies Europe's_______center.ill mark the person who answers it first nurses on a hospital unit have been informed that a change to the documentation system is being proposed. what factor surrounding this change is most likely to cause unfreezing? what is 15 plus 124 = type the answer in the box I need an essay for Is Chocolate Good for Cte d'Ivoire? Evaluate 63 47. i need help asap cassie is placing stickers on a page that is 12 inches long and 8 inches wide the sticker are 3 inches long and 2 inches wide 6x + 26x - 10 = 8(4x + 10)how many solutions? information security is not just about technology, but also about management and _______ HELP !! Im also being timed.. sighs What is the main idea of feminism? research suggests that there are 10 primary characteristics that, in aggregate, capture the essence of an organization's culture. match these characteristics with their descriptions. vector c has a magnitude of 27.0 m and points in the y direction. vectors a and b both have positive y components, and make angles of Fatigue is a failure caused by a repetitive or fluctuating stress that is much lower than that required to cause fracture on a single application of load.(A) True(B) False Define inclusivness? the basic argument for skepticism has which argument form? group of answer choices modus ponens modus tollens hypothetical syllogism disjunctive syllogism denying the antecedent Write a polynomial function with given zeros 8, 10 The repair of the epidermis after a wound begins as basal cells produce newA) elastic fibersB) collagen fibersC) reticular fibersD) dense connective tissueE) keratinocytes